C27H30N2O4S — CID 46590461
1-(4-methylphenyl)sulfonyl-N-[(4-phenylmethoxyphenyl)methyl]piperidine-4-carboxamide (PubChem CID 46590461) has the molecular formula C27H30N2O4S and a molecular weight of 478.61 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-N-[(4-phenylmethoxyphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-methylphenyl)sulfonyl-N-[(4-phenylmethoxyphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46590461 |
| Molecular Formula | C27H30N2O4S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-N-[(4-phenylmethoxyphenyl)methyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)NCc3ccc(OCc4ccccc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H30N2O4S/c1-21-7-13-26(14-8-21)34(31,32)29-17-15-24(16-18-29)27(30)28-19-22-9-11-25(12-10-22)33-20-23-5-3-2-4-6-23/h2-14,24H,15-20H2,1H3,(H,28,30) |
| InChIKey | JHJADYDVXAPMOQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |