C28H30N2O5S — CID 23880152
[2-(dibenzylamino)-2-oxoethyl] 4-piperidin-1-ylsulfonylbenzoate (PubChem CID 23880152) has the molecular formula C28H30N2O5S and a molecular weight of 506.62 g/mol. Its IUPAC name is [2-(dibenzylamino)-2-oxoethyl] 4-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(dibenzylamino)-2-oxoethyl] 4-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 23880152 |
| Molecular Formula | C28H30N2O5S |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | [2-(dibenzylamino)-2-oxoethyl] 4-piperidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OCC(=O)N(Cc1ccccc1)Cc1ccccc1)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C28H30N2O5S/c31-27(29(20-23-10-4-1-5-11-23)21-24-12-6-2-7-13-24)22-35-28(32)25-14-16-26(17-15-25)36(33,34)30-18-8-3-9-19-30/h1-2,4-7,10-17H,3,8-9,18-22H2 |
| InChIKey | IZVXRBNQIJLTTC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |