C25H37N3O4S — CID 55566906
1-[4-(2-cyclopentylacetyl)piperazin-1-yl]-3-(4-piperidin-1-ylsulfonylphenyl)propan-1-one (PubChem CID 55566906) has the molecular formula C25H37N3O4S and a molecular weight of 475.66 g/mol. Its IUPAC name is 1-[4-(2-cyclopentylacetyl)piperazin-1-yl]-3-(4-piperidin-1-ylsulfonylphenyl)propan-1-one.
| Compound Name | 1-[4-(2-cyclopentylacetyl)piperazin-1-yl]-3-(4-piperidin-1-ylsulfonylphenyl)propan-1-one |
|---|---|
| PubChem CID | 55566906 |
| Molecular Formula | C25H37N3O4S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 1-[4-(2-cyclopentylacetyl)piperazin-1-yl]-3-(4-piperidin-1-ylsulfonylphenyl)propan-1-one |
| SMILES | O=C(CCc1ccc(S(=O)(=O)N2CCCCC2)cc1)N1CCN(C(=O)CC2CCCC2)CC1 |
| InChI | InChI=1S/C25H37N3O4S/c29-24(26-16-18-27(19-17-26)25(30)20-22-6-2-3-7-22)13-10-21-8-11-23(12-9-21)33(31,32)28-14-4-1-5-15-28/h8-9,11-12,22H,1-7,10,13-20H2 |
| InChIKey | WJGZSZDTAUFDKQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |