C22H31N3O5S — CID 55451032
1-[4-(oxolane-2-carbonyl)piperazin-1-yl]-3-(4-pyrrolidin-1-ylsulfonylphenyl)propan-1-one (PubChem CID 55451032) has the molecular formula C22H31N3O5S and a molecular weight of 449.57 g/mol. Its IUPAC name is 1-[4-(oxolane-2-carbonyl)piperazin-1-yl]-3-(4-pyrrolidin-1-ylsulfonylphenyl)propan-1-one.
| Compound Name | 1-[4-(oxolane-2-carbonyl)piperazin-1-yl]-3-(4-pyrrolidin-1-ylsulfonylphenyl)propan-1-one |
|---|---|
| PubChem CID | 55451032 |
| Molecular Formula | C22H31N3O5S |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 1-[4-(oxolane-2-carbonyl)piperazin-1-yl]-3-(4-pyrrolidin-1-ylsulfonylphenyl)propan-1-one |
| SMILES | O=C(CCc1ccc(S(=O)(=O)N2CCCC2)cc1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C22H31N3O5S/c26-21(23-13-15-24(16-14-23)22(27)20-4-3-17-30-20)10-7-18-5-8-19(9-6-18)31(28,29)25-11-1-2-12-25/h5-6,8-9,20H,1-4,7,10-17H2 |
| InChIKey | IFXUXMPMWYRYQS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |