C20H28N4O6S — CID 55346931
[4-(2-nitro-4-piperidin-1-ylsulfonylphenyl)piperazin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 55346931) has the molecular formula C20H28N4O6S and a molecular weight of 452.53 g/mol. Its IUPAC name is [4-(2-nitro-4-piperidin-1-ylsulfonylphenyl)piperazin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [4-(2-nitro-4-piperidin-1-ylsulfonylphenyl)piperazin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 55346931 |
| Molecular Formula | C20H28N4O6S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | [4-(2-nitro-4-piperidin-1-ylsulfonylphenyl)piperazin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | O=C(C1CCCO1)N1CCN(c2ccc(S(=O)(=O)N3CCCCC3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H28N4O6S/c25-20(19-5-4-14-30-19)22-12-10-21(11-13-22)17-7-6-16(15-18(17)24(26)27)31(28,29)23-8-2-1-3-9-23/h6-7,15,19H,1-5,8-14H2 |
| InChIKey | VJOKRRCRBBTBQW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 113.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|