C22H32N4O6S — CID 16960891
(4-methylpiperidin-1-yl)-[1-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperidin-4-yl]methanone (PubChem CID 16960891) has the molecular formula C22H32N4O6S and a molecular weight of 480.59 g/mol. Its IUPAC name is (4-methylpiperidin-1-yl)-[1-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperidin-4-yl]methanone.
| Compound Name | (4-methylpiperidin-1-yl)-[1-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 16960891 |
| Molecular Formula | C22H32N4O6S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | (4-methylpiperidin-1-yl)-[1-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperidin-4-yl]methanone |
| SMILES | CC1CCN(C(=O)C2CCN(c3ccc(S(=O)(=O)N4CCOCC4)cc3[N+](=O)[O-])CC2)CC1 |
| InChI | InChI=1S/C22H32N4O6S/c1-17-4-8-24(9-5-17)22(27)18-6-10-23(11-7-18)20-3-2-19(16-21(20)26(28)29)33(30,31)25-12-14-32-15-13-25/h2-3,16-18H,4-15H2,1H3 |
| InChIKey | CDUNDPUXGFWKMF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 113.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|