C17H25N3O5S — CID 9279241
4-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitrophenyl]morpholine (PubChem CID 9279241) has the molecular formula C17H25N3O5S and a molecular weight of 383.47 g/mol. Its IUPAC name is 4-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitrophenyl]morpholine.
| Compound Name | 4-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitrophenyl]morpholine |
|---|---|
| PubChem CID | 9279241 |
| Molecular Formula | C17H25N3O5S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 4-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitrophenyl]morpholine |
| SMILES | C[C@@H]1C[C@@H](C)CN(S(=O)(=O)c2ccc(N3CCOCC3)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C17H25N3O5S/c1-13-9-14(2)12-19(11-13)26(23,24)15-3-4-16(17(10-15)20(21)22)18-5-7-25-8-6-18/h3-4,10,13-14H,5-9,11-12H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | MNPLYTVTQAJHFY-ZIAGYGMSSA-N |
| XLogP | 2.10 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|