C16H23N3O5S — CID 8933248
(2R,6R)-2,6-dimethyl-4-(2-nitro-4-pyrrolidin-1-ylsulfonylphenyl)morpholine (PubChem CID 8933248) has the molecular formula C16H23N3O5S and a molecular weight of 369.44 g/mol. Its IUPAC name is (2R,6R)-2,6-dimethyl-4-(2-nitro-4-pyrrolidin-1-ylsulfonylphenyl)morpholine.
| Compound Name | (2R,6R)-2,6-dimethyl-4-(2-nitro-4-pyrrolidin-1-ylsulfonylphenyl)morpholine |
|---|---|
| PubChem CID | 8933248 |
| Molecular Formula | C16H23N3O5S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | (2R,6R)-2,6-dimethyl-4-(2-nitro-4-pyrrolidin-1-ylsulfonylphenyl)morpholine |
| SMILES | C[C@@H]1CN(c2ccc(S(=O)(=O)N3CCCC3)cc2[N+](=O)[O-])C[C@@H](C)O1 |
| InChI | InChI=1S/C16H23N3O5S/c1-12-10-17(11-13(2)24-12)15-6-5-14(9-16(15)19(20)21)25(22,23)18-7-3-4-8-18/h5-6,9,12-13H,3-4,7-8,10-11H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | JEJNDPISSYOIRT-CHWSQXEVSA-N |
| XLogP | 1.99 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|