C16H23N3O5S — CID 9311200
[(3R)-1-(2-nitro-4-pyrrolidin-1-ylsulfonylphenyl)piperidin-3-yl]methanol (PubChem CID 9311200) has the molecular formula C16H23N3O5S and a molecular weight of 369.44 g/mol. Its IUPAC name is [(3R)-1-(2-nitro-4-pyrrolidin-1-ylsulfonylphenyl)piperidin-3-yl]methanol.
| Compound Name | [(3R)-1-(2-nitro-4-pyrrolidin-1-ylsulfonylphenyl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 9311200 |
| Molecular Formula | C16H23N3O5S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | [(3R)-1-(2-nitro-4-pyrrolidin-1-ylsulfonylphenyl)piperidin-3-yl]methanol |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCCC2)ccc1N1CCC[C@@H](CO)C1 |
| InChI | InChI=1S/C16H23N3O5S/c20-12-13-4-3-7-17(11-13)15-6-5-14(10-16(15)19(21)22)25(23,24)18-8-1-2-9-18/h5-6,10,13,20H,1-4,7-9,11-12H2/t13-/m1/s1 |
| InChIKey | VGWNWFYZQXTXPO-CYBMUJFWSA-N |
| XLogP | 1.59 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|