C22H34N4O4S — CID 129419099
(3S)-3-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]-1-(2-nitro-4-piperidin-1-ylsulfonylphenyl)piperidine (PubChem CID 129419099) has the molecular formula C22H34N4O4S and a molecular weight of 450.61 g/mol. Its IUPAC name is (3S)-3-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]-1-(2-nitro-4-piperidin-1-ylsulfonylphenyl)piperidine.
| Compound Name | (3S)-3-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]-1-(2-nitro-4-piperidin-1-ylsulfonylphenyl)piperidine |
|---|---|
| PubChem CID | 129419099 |
| Molecular Formula | C22H34N4O4S |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | (3S)-3-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]-1-(2-nitro-4-piperidin-1-ylsulfonylphenyl)piperidine |
| SMILES | C[C@@H]1CC[C@@H](C)N1[C@H]1CCCN(c2ccc(S(=O)(=O)N3CCCCC3)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C22H34N4O4S/c1-17-8-9-18(2)25(17)19-7-6-12-23(16-19)21-11-10-20(15-22(21)26(27)28)31(29,30)24-13-4-3-5-14-24/h10-11,15,17-19H,3-9,12-14,16H2,1-2H3/t17-,18-,19+/m1/s1 |
| InChIKey | XZYJFTCOIUPDHU-QRVBRYPASA-N |
| XLogP | 3.61 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|