C20H28N6O4S — CID 133363811
1-[4-[3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]-3-nitrophenyl]sulfonylazepane (PubChem CID 133363811) has the molecular formula C20H28N6O4S and a molecular weight of 448.55 g/mol. Its IUPAC name is 1-[4-[3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]-3-nitrophenyl]sulfonylazepane.
| Compound Name | 1-[4-[3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]-3-nitrophenyl]sulfonylazepane |
|---|---|
| PubChem CID | 133363811 |
| Molecular Formula | C20H28N6O4S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 1-[4-[3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]-3-nitrophenyl]sulfonylazepane |
| SMILES | Cc1nc(C2CCCN(c3ccc(S(=O)(=O)N4CCCCCC4)cc3[N+](=O)[O-])C2)n[nH]1 |
| InChI | InChI=1S/C20H28N6O4S/c1-15-21-20(23-22-15)16-7-6-10-24(14-16)18-9-8-17(13-19(18)26(27)28)31(29,30)25-11-4-2-3-5-12-25/h8-9,13,16H,2-7,10-12,14H2,1H3,(H,21,22,23) |
| InChIKey | UJHNZRYKYSILJI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 125.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|