C23H28N6O4S — CID 27869333
3-[(3R)-1-[4-(4-methylpiperidin-1-yl)sulfonyl-2-nitrophenyl]piperidin-3-yl]-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 27869333) has the molecular formula C23H28N6O4S and a molecular weight of 484.58 g/mol. Its IUPAC name is 3-[(3R)-1-[4-(4-methylpiperidin-1-yl)sulfonyl-2-nitrophenyl]piperidin-3-yl]-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-[(3R)-1-[4-(4-methylpiperidin-1-yl)sulfonyl-2-nitrophenyl]piperidin-3-yl]-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 27869333 |
| Molecular Formula | C23H28N6O4S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 3-[(3R)-1-[4-(4-methylpiperidin-1-yl)sulfonyl-2-nitrophenyl]piperidin-3-yl]-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(N3CCC[C@@H](c4nnc5ccccn45)C3)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C23H28N6O4S/c1-17-9-13-27(14-10-17)34(32,33)19-7-8-20(21(15-19)29(30)31)26-11-4-5-18(16-26)23-25-24-22-6-2-3-12-28(22)23/h2-3,6-8,12,15,17-18H,4-5,9-11,13-14,16H2,1H3/t18-/m1/s1 |
| InChIKey | FJRCAIVGKVRSQB-GOSISDBHSA-N |
| XLogP | 3.44 |
| TPSA | 113.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|