C23H26N6O3 — CID 38717695
[4-[(3R)-3-methylpiperidin-1-yl]-3-nitrophenyl]-[(2R)-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]methanone (PubChem CID 38717695) has the molecular formula C23H26N6O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is [4-[(3R)-3-methylpiperidin-1-yl]-3-nitrophenyl]-[(2R)-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]methanone.
| Compound Name | [4-[(3R)-3-methylpiperidin-1-yl]-3-nitrophenyl]-[(2R)-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 38717695 |
| Molecular Formula | C23H26N6O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | [4-[(3R)-3-methylpiperidin-1-yl]-3-nitrophenyl]-[(2R)-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]methanone |
| SMILES | C[C@@H]1CCCN(c2ccc(C(=O)N3CCC[C@@H]3c3nnc4ccccn34)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C23H26N6O3/c1-16-6-4-11-26(15-16)18-10-9-17(14-20(18)29(31)32)23(30)27-13-5-7-19(27)22-25-24-21-8-2-3-12-28(21)22/h2-3,8-10,12,14,16,19H,4-7,11,13,15H2,1H3/t16-,19-/m1/s1 |
| InChIKey | HAZQOZPPBDFGEG-VQIMIIECSA-N |
| XLogP | 3.85 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|