C23H23F3N6O3 — CID 38720533
[1-[2-nitro-4-(trifluoromethyl)phenyl]piperidin-4-yl]-[(2R)-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]methanone (PubChem CID 38720533) has the molecular formula C23H23F3N6O3 and a molecular weight of 488.47 g/mol. Its IUPAC name is [1-[2-nitro-4-(trifluoromethyl)phenyl]piperidin-4-yl]-[(2R)-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]methanone.
| Compound Name | [1-[2-nitro-4-(trifluoromethyl)phenyl]piperidin-4-yl]-[(2R)-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 38720533 |
| Molecular Formula | C23H23F3N6O3 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | [1-[2-nitro-4-(trifluoromethyl)phenyl]piperidin-4-yl]-[(2R)-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(C1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1)N1CCC[C@@H]1c1nnc2ccccn12 |
| InChI | InChI=1S/C23H23F3N6O3/c24-23(25,26)16-6-7-17(19(14-16)32(34)35)29-12-8-15(9-13-29)22(33)30-11-3-4-18(30)21-28-27-20-5-1-2-10-31(20)21/h1-2,5-7,10,14-15,18H,3-4,8-9,11-13H2/t18-/m1/s1 |
| InChIKey | ZWMABFAUWLEVIA-GOSISDBHSA-N |
| XLogP | 4.24 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|