C23H27F3N6O3 — CID 97076675
[(3R)-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)piperidin-1-yl]-[1-[2-nitro-4-(trifluoromethyl)phenyl]piperidin-4-yl]methanone (PubChem CID 97076675) has the molecular formula C23H27F3N6O3 and a molecular weight of 492.50 g/mol. Its IUPAC name is [(3R)-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)piperidin-1-yl]-[1-[2-nitro-4-(trifluoromethyl)phenyl]piperidin-4-yl]methanone.
| Compound Name | [(3R)-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)piperidin-1-yl]-[1-[2-nitro-4-(trifluoromethyl)phenyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 97076675 |
| Molecular Formula | C23H27F3N6O3 |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | [(3R)-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)piperidin-1-yl]-[1-[2-nitro-4-(trifluoromethyl)phenyl]piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1)N1CCC[C@@H](c2nnc3n2CCC3)C1 |
| InChI | InChI=1S/C23H27F3N6O3/c24-23(25,26)17-5-6-18(19(13-17)32(34)35)29-11-7-15(8-12-29)22(33)30-9-1-3-16(14-30)21-28-27-20-4-2-10-31(20)21/h5-6,13,15-16H,1-4,7-12,14H2/t16-/m1/s1 |
| InChIKey | SRIZMTBHYDUNJH-MRXNPFEDSA-N |
| XLogP | 3.77 |
| TPSA | 97.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|