C22H23F3N4O4S — CID 32756616
[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-[1-(thiophene-2-carbonyl)piperidin-4-yl]methanone (PubChem CID 32756616) has the molecular formula C22H23F3N4O4S and a molecular weight of 496.51 g/mol. Its IUPAC name is [4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-[1-(thiophene-2-carbonyl)piperidin-4-yl]methanone.
| Compound Name | [4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-[1-(thiophene-2-carbonyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 32756616 |
| Molecular Formula | C22H23F3N4O4S |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | [4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-[1-(thiophene-2-carbonyl)piperidin-4-yl]methanone |
| SMILES | O=C(c1cccs1)N1CCC(C(=O)N2CCN(c3ccc(C(F)(F)F)cc3[N+](=O)[O-])CC2)CC1 |
| InChI | InChI=1S/C22H23F3N4O4S/c23-22(24,25)16-3-4-17(18(14-16)29(32)33)26-9-11-28(12-10-26)20(30)15-5-7-27(8-6-15)21(31)19-2-1-13-34-19/h1-4,13-15H,5-12H2 |
| InChIKey | LTZIWFNRHTVQTI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|