C17H21F3N4O3 — CID 133279907
(1-methylpyrrolidin-2-yl)-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 133279907) has the molecular formula C17H21F3N4O3 and a molecular weight of 386.37 g/mol. Its IUPAC name is (1-methylpyrrolidin-2-yl)-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | (1-methylpyrrolidin-2-yl)-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 133279907 |
| Molecular Formula | C17H21F3N4O3 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (1-methylpyrrolidin-2-yl)-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | CN1CCCC1C(=O)N1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H21F3N4O3/c1-21-6-2-3-14(21)16(25)23-9-7-22(8-10-23)13-5-4-12(17(18,19)20)11-15(13)24(26)27/h4-5,11,14H,2-3,6-10H2,1H3 |
| InChIKey | AWVUQXRVKGQWFP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 69.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|