C17H22F3N3O3S — CID 112793759
2-tert-butylsulfanyl-1-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone (PubChem CID 112793759) has the molecular formula C17H22F3N3O3S and a molecular weight of 405.44 g/mol. Its IUPAC name is 2-tert-butylsulfanyl-1-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone.
| Compound Name | 2-tert-butylsulfanyl-1-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 112793759 |
| Molecular Formula | C17H22F3N3O3S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 2-tert-butylsulfanyl-1-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone |
| SMILES | CC(C)(C)SCC(=O)N1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H22F3N3O3S/c1-16(2,3)27-11-15(24)22-8-6-21(7-9-22)13-5-4-12(17(18,19)20)10-14(13)23(25)26/h4-5,10H,6-9,11H2,1-3H3 |
| InChIKey | XAHVQMIREVAISL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|