C15H20ClF3N4O3 — CID 119684234
3-amino-1-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]butan-1-one;hydrochloride (PubChem CID 119684234) has the molecular formula C15H20ClF3N4O3 and a molecular weight of 396.80 g/mol. Its IUPAC name is 3-amino-1-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]butan-1-one;hydrochloride.
| Compound Name | 3-amino-1-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119684234 |
| Molecular Formula | C15H20ClF3N4O3 |
| Molecular Weight | 396.80 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 3-amino-1-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]butan-1-one;hydrochloride |
| SMILES | CC(N)CC(=O)N1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1.Cl |
| InChI | InChI=1S/C15H19F3N4O3.ClH/c1-10(19)8-14(23)21-6-4-20(5-7-21)12-3-2-11(15(16,17)18)9-13(12)22(24)25;/h2-3,9-10H,4-8,19H2,1H3;1H |
| InChIKey | SAJPEFLVNVHUAZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.80 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|