C20H27F3N4O4 — CID 32745382
2,2-dimethyl-N-[4-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-4-oxobutyl]propanamide (PubChem CID 32745382) has the molecular formula C20H27F3N4O4 and a molecular weight of 444.45 g/mol. Its IUPAC name is 2,2-dimethyl-N-[4-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-4-oxobutyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[4-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-4-oxobutyl]propanamide |
|---|---|
| PubChem CID | 32745382 |
| Molecular Formula | C20H27F3N4O4 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 2,2-dimethyl-N-[4-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-4-oxobutyl]propanamide |
| SMILES | CC(C)(C)C(=O)NCCCC(=O)N1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H27F3N4O4/c1-19(2,3)18(29)24-8-4-5-17(28)26-11-9-25(10-12-26)15-7-6-14(20(21,22)23)13-16(15)27(30)31/h6-7,13H,4-5,8-12H2,1-3H3,(H,24,29) |
| InChIKey | KQKAYNLVZJAKSH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|