C15H17F3N4O5 — CID 122019501
3-[[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazine-1-carbonyl]amino]propanoic acid (PubChem CID 122019501) has the molecular formula C15H17F3N4O5 and a molecular weight of 390.32 g/mol. Its IUPAC name is 3-[[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazine-1-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazine-1-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122019501 |
| Molecular Formula | C15H17F3N4O5 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 3-[[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazine-1-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)N1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H17F3N4O5/c16-15(17,18)10-1-2-11(12(9-10)22(26)27)20-5-7-21(8-6-20)14(25)19-4-3-13(23)24/h1-2,9H,3-8H2,(H,19,25)(H,23,24) |
| InChIKey | HSKUKBWEHSNFDI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 116.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|