C16H21F3N4O3 — CID 36911796
N-butyl-4-[2-nitro-4-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 36911796) has the molecular formula C16H21F3N4O3 and a molecular weight of 374.36 g/mol. Its IUPAC name is N-butyl-4-[2-nitro-4-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | N-butyl-4-[2-nitro-4-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 36911796 |
| Molecular Formula | C16H21F3N4O3 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | N-butyl-4-[2-nitro-4-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H21F3N4O3/c1-2-3-6-20-15(24)22-9-7-21(8-10-22)13-5-4-12(16(17,18)19)11-14(13)23(25)26/h4-5,11H,2-3,6-10H2,1H3,(H,20,24) |
| InChIKey | HIJNVTVOZLYHFL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|