C16H21ClF3N3O — CID 113103935
N-butyl-4-[4-chloro-2-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 113103935) has the molecular formula C16H21ClF3N3O and a molecular weight of 363.81 g/mol. Its IUPAC name is N-butyl-4-[4-chloro-2-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | N-butyl-4-[4-chloro-2-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113103935 |
| Molecular Formula | C16H21ClF3N3O |
| Molecular Weight | 363.81 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | N-butyl-4-[4-chloro-2-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCN(c2ccc(Cl)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H21ClF3N3O/c1-2-3-6-21-15(24)23-9-7-22(8-10-23)14-5-4-12(17)11-13(14)16(18,19)20/h4-5,11H,2-3,6-10H2,1H3,(H,21,24) |
| InChIKey | ANJBYKRQWHGSLP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|