C18H24ClN4O+ — CID 7189220
N-butyl-4-(7-chloroquinolin-1-ium-4-yl)piperazine-1-carboxamide (PubChem CID 7189220) has the molecular formula C18H24ClN4O+ and a molecular weight of 347.87 g/mol. Its IUPAC name is N-butyl-4-(7-chloroquinolin-1-ium-4-yl)piperazine-1-carboxamide.
| Compound Name | N-butyl-4-(7-chloroquinolin-1-ium-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 7189220 |
| Molecular Formula | C18H24ClN4O+ |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | N-butyl-4-(7-chloroquinolin-1-ium-4-yl)piperazine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCN(c2cc[nH+]c3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C18H23ClN4O/c1-2-3-7-21-18(24)23-11-9-22(10-12-23)17-6-8-20-16-13-14(19)4-5-15(16)17/h4-6,8,13H,2-3,7,9-12H2,1H3,(H,21,24)/p+1 |
| InChIKey | ZPMLDXVANWTUCU-UHFFFAOYSA-O |
| XLogP | 2.94 |
| TPSA | 49.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|