C19H24F3N4O+ — CID 7211138
N-butyl-4-[2-(trifluoromethyl)quinolin-1-ium-4-yl]piperazine-1-carboxamide (PubChem CID 7211138) has the molecular formula C19H24F3N4O+ and a molecular weight of 381.42 g/mol. Its IUPAC name is N-butyl-4-[2-(trifluoromethyl)quinolin-1-ium-4-yl]piperazine-1-carboxamide.
| Compound Name | N-butyl-4-[2-(trifluoromethyl)quinolin-1-ium-4-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 7211138 |
| Molecular Formula | C19H24F3N4O+ |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | N-butyl-4-[2-(trifluoromethyl)quinolin-1-ium-4-yl]piperazine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCN(c2cc(C(F)(F)F)[nH+]c3ccccc23)CC1 |
| InChI | InChI=1S/C19H23F3N4O/c1-2-3-8-23-18(27)26-11-9-25(10-12-26)16-13-17(19(20,21)22)24-15-7-5-4-6-14(15)16/h4-7,13H,2-3,8-12H2,1H3,(H,23,27)/p+1 |
| InChIKey | ZCLIGLFBUSIRKL-UHFFFAOYSA-O |
| XLogP | 3.30 |
| TPSA | 49.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|