C21H20F3N4O+ — CID 7211127
N-phenyl-4-[2-(trifluoromethyl)quinolin-1-ium-4-yl]piperazine-1-carboxamide (PubChem CID 7211127) has the molecular formula C21H20F3N4O+ and a molecular weight of 401.41 g/mol. Its IUPAC name is N-phenyl-4-[2-(trifluoromethyl)quinolin-1-ium-4-yl]piperazine-1-carboxamide.
| Compound Name | N-phenyl-4-[2-(trifluoromethyl)quinolin-1-ium-4-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 7211127 |
| Molecular Formula | C21H20F3N4O+ |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | N-phenyl-4-[2-(trifluoromethyl)quinolin-1-ium-4-yl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1CCN(c2cc(C(F)(F)F)[nH+]c3ccccc23)CC1 |
| InChI | InChI=1S/C21H19F3N4O/c22-21(23,24)19-14-18(16-8-4-5-9-17(16)26-19)27-10-12-28(13-11-27)20(29)25-15-6-2-1-3-7-15/h1-9,14H,10-13H2,(H,25,29)/p+1 |
| InChIKey | NEKVFAVYCXJFHU-UHFFFAOYSA-O |
| XLogP | 4.03 |
| TPSA | 49.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |