C20H22F3N3O — CID 113111996
4-(2-ethylphenyl)-N-[4-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 113111996) has the molecular formula C20H22F3N3O and a molecular weight of 377.41 g/mol. Its IUPAC name is 4-(2-ethylphenyl)-N-[4-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-(2-ethylphenyl)-N-[4-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113111996 |
| Molecular Formula | C20H22F3N3O |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 4-(2-ethylphenyl)-N-[4-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | CCc1ccccc1N1CCN(C(=O)Nc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H22F3N3O/c1-2-15-5-3-4-6-18(15)25-11-13-26(14-12-25)19(27)24-17-9-7-16(8-10-17)20(21,22)23/h3-10H,2,11-14H2,1H3,(H,24,27) |
| InChIKey | FBKUUTUOZYXUKN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |