C18H16F6N4O — CID 11430023
N-[4-(trifluoromethyl)phenyl]-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide (PubChem CID 11430023) has the molecular formula C18H16F6N4O and a molecular weight of 418.34 g/mol. Its IUPAC name is N-[4-(trifluoromethyl)phenyl]-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide.
| Compound Name | N-[4-(trifluoromethyl)phenyl]-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 11430023 |
| Molecular Formula | C18H16F6N4O |
| Molecular Weight | 418.34 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-[4-(trifluoromethyl)phenyl]-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)N1CCN(c2ncccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H16F6N4O/c19-17(20,21)12-3-5-13(6-4-12)26-16(29)28-10-8-27(9-11-28)15-14(18(22,23)24)2-1-7-25-15/h1-7H,8-11H2,(H,26,29) |
| InChIKey | FADBMGBZPIJMIQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.34 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |