C16H14Cl2F3N5O — CID 11539011
N-(5,6-dichloro-2-pyridinyl)-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide (PubChem CID 11539011) has the molecular formula C16H14Cl2F3N5O and a molecular weight of 420.22 g/mol. Its IUPAC name is N-(5,6-dichloro-2-pyridinyl)-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide.
| Compound Name | N-(5,6-dichloro-2-pyridinyl)-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 11539011 |
| Molecular Formula | C16H14Cl2F3N5O |
| Molecular Weight | 420.22 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | N-(5,6-dichloro-2-pyridinyl)-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)n1)N1CCN(c2ncccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H14Cl2F3N5O/c17-11-3-4-12(23-13(11)18)24-15(27)26-8-6-25(7-9-26)14-10(16(19,20)21)2-1-5-22-14/h1-5H,6-9H2,(H,23,24,27) |
| InChIKey | XGCDXEFHLPMYBD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.22 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|