C19H17ClF3N3O — CID 69457330
3-(3-chlorophenyl)-1-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 69457330) has the molecular formula C19H17ClF3N3O and a molecular weight of 395.81 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(3-chlorophenyl)-1-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 69457330 |
| Molecular Formula | C19H17ClF3N3O |
| Molecular Weight | 395.81 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1cccc(Cl)c1)N1CCN(c2ncccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H17ClF3N3O/c20-15-4-1-3-14(13-15)6-7-17(27)25-9-11-26(12-10-25)18-16(19(21,22)23)5-2-8-24-18/h1-8,13H,9-12H2 |
| InChIKey | NQRSQVSYPJPSRT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.81 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|