C19H18ClF3N3O+ — CID 8504186
(E)-3-(3-chlorophenyl)-1-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 8504186) has the molecular formula C19H18ClF3N3O+ and a molecular weight of 396.82 g/mol. Its IUPAC name is (E)-3-(3-chlorophenyl)-1-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-chlorophenyl)-1-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 8504186 |
| Molecular Formula | C19H18ClF3N3O+ |
| Molecular Weight | 396.82 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | (E)-3-(3-chlorophenyl)-1-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc(Cl)c1)N1CCN(c2ccc(C(F)(F)F)c[nH+]2)CC1 |
| InChI | InChI=1S/C19H17ClF3N3O/c20-16-3-1-2-14(12-16)4-7-18(27)26-10-8-25(9-11-26)17-6-5-15(13-24-17)19(21,22)23/h1-7,12-13H,8-11H2/p+1/b7-4+ |
| InChIKey | XTLGRSBNHHAUON-QPJJXVBHSA-O |
| XLogP | 3.53 |
| TPSA | 37.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.82 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|