C20H21F3N3O2+ — CID 8504188
(E)-3-(3-methoxyphenyl)-1-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 8504188) has the molecular formula C20H21F3N3O2+ and a molecular weight of 392.40 g/mol. Its IUPAC name is (E)-3-(3-methoxyphenyl)-1-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-methoxyphenyl)-1-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 8504188 |
| Molecular Formula | C20H21F3N3O2+ |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (E)-3-(3-methoxyphenyl)-1-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | COc1cccc(/C=C/C(=O)N2CCN(c3ccc(C(F)(F)F)c[nH+]3)CC2)c1 |
| InChI | InChI=1S/C20H20F3N3O2/c1-28-17-4-2-3-15(13-17)5-8-19(27)26-11-9-25(10-12-26)18-7-6-16(14-24-18)20(21,22)23/h2-8,13-14H,9-12H2,1H3/p+1/b8-5+ |
| InChIKey | IQWVTQURCAKRLK-VMPITWQZSA-O |
| XLogP | 2.89 |
| TPSA | 46.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|