C23H23ClF3N3O3 — CID 173045059
N-hydroxy-3-[3-[3-oxo-3-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]prop-1-enyl]phenyl]prop-2-enamide;hydrochloride (PubChem CID 173045059) has the molecular formula C23H23ClF3N3O3 and a molecular weight of 481.90 g/mol. Its IUPAC name is N-hydroxy-3-[3-[3-oxo-3-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]prop-1-enyl]phenyl]prop-2-enamide;hydrochloride.
| Compound Name | N-hydroxy-3-[3-[3-oxo-3-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]prop-1-enyl]phenyl]prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 173045059 |
| Molecular Formula | C23H23ClF3N3O3 |
| Molecular Weight | 481.90 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | N-hydroxy-3-[3-[3-oxo-3-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]prop-1-enyl]phenyl]prop-2-enamide;hydrochloride |
| SMILES | Cl.O=C(C=Cc1cccc(C=CC(=O)N2CCN(c3ccc(C(F)(F)F)cc3)CC2)c1)NO |
| InChI | InChI=1S/C23H22F3N3O3.ClH/c24-23(25,26)19-6-8-20(9-7-19)28-12-14-29(15-13-28)22(31)11-5-18-3-1-2-17(16-18)4-10-21(30)27-32;/h1-11,16,32H,12-15H2,(H,27,30);1H |
| InChIKey | JTPCRDZCWUSCBM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.90 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|