C22H23F3N2O — CID 9154747
(E)-1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 9154747) has the molecular formula C22H23F3N2O and a molecular weight of 388.43 g/mol. Its IUPAC name is (E)-1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 9154747 |
| Molecular Formula | C22H23F3N2O |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (E)-1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | Cc1cccc(N2CCN(C(=O)/C=C/c3ccc(C(F)(F)F)cc3)CC2)c1C |
| InChI | InChI=1S/C22H23F3N2O/c1-16-4-3-5-20(17(16)2)26-12-14-27(15-13-26)21(28)11-8-18-6-9-19(10-7-18)22(23,24)25/h3-11H,12-15H2,1-2H3/b11-8+ |
| InChIKey | ZZAWGOBMEDHEDO-DHZHZOJOSA-N |
| XLogP | 4.68 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|