C19H22N2OS — CID 844969
1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 844969) has the molecular formula C19H22N2OS and a molecular weight of 326.47 g/mol. Its IUPAC name is 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one.
| Compound Name | 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 844969 |
| Molecular Formula | C19H22N2OS |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | Cc1cccc(N2CCN(C(=O)C=Cc3cccs3)CC2)c1C |
| InChI | InChI=1S/C19H22N2OS/c1-15-5-3-7-18(16(15)2)20-10-12-21(13-11-20)19(22)9-8-17-6-4-14-23-17/h3-9,14H,10-13H2,1-2H3 |
| InChIKey | BPIBHUDJOKNCCN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|