C16H18F3N3O2 — CID 72687307
4-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]-1,4-diazepane-1-carboxamide (PubChem CID 72687307) has the molecular formula C16H18F3N3O2 and a molecular weight of 341.33 g/mol. Its IUPAC name is 4-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]-1,4-diazepane-1-carboxamide.
| Compound Name | 4-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 72687307 |
| Molecular Formula | C16H18F3N3O2 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 4-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]-1,4-diazepane-1-carboxamide |
| SMILES | NC(=O)N1CCCN(C(=O)C=Cc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H18F3N3O2/c17-16(18,19)13-5-2-12(3-6-13)4-7-14(23)21-8-1-9-22(11-10-21)15(20)24/h2-7H,1,8-11H2,(H2,20,24) |
| InChIKey | JYRSBPBXRAKZMY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|