C17H22N2O2 — CID 134026519
(E)-1-(4-acetyl-1,4-diazepan-1-yl)-3-(4-methylphenyl)prop-2-en-1-one (PubChem CID 134026519) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is (E)-1-(4-acetyl-1,4-diazepan-1-yl)-3-(4-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-acetyl-1,4-diazepan-1-yl)-3-(4-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 134026519 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (E)-1-(4-acetyl-1,4-diazepan-1-yl)-3-(4-methylphenyl)prop-2-en-1-one |
| SMILES | CC(=O)N1CCCN(C(=O)/C=C/c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C17H22N2O2/c1-14-4-6-16(7-5-14)8-9-17(21)19-11-3-10-18(12-13-19)15(2)20/h4-9H,3,10-13H2,1-2H3/b9-8+ |
| InChIKey | FMOGSNJCHYSTQM-CMDGGOBGSA-N |
| XLogP | 2.09 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|