C27H32N2O4 — CID 17228057
(E)-3-(4-ethoxyphenyl)-1-[4-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]-1,4-diazepan-1-yl]prop-2-en-1-one (PubChem CID 17228057) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is (E)-3-(4-ethoxyphenyl)-1-[4-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]-1,4-diazepan-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-ethoxyphenyl)-1-[4-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]-1,4-diazepan-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 17228057 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | (E)-3-(4-ethoxyphenyl)-1-[4-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]-1,4-diazepan-1-yl]prop-2-en-1-one |
| SMILES | CCOc1ccc(/C=C/C(=O)N2CCCN(C(=O)/C=C/c3ccc(OCC)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H32N2O4/c1-3-32-24-12-6-22(7-13-24)10-16-26(30)28-18-5-19-29(21-20-28)27(31)17-11-23-8-14-25(15-9-23)33-4-2/h6-17H,3-5,18-21H2,1-2H3/b16-10+,17-11+ |
| InChIKey | VZYFLZMZGFEFLI-OTYYAQKOSA-N |
| XLogP | 4.27 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|