C28H28Br2N2O2 — CID 123767129
1-[4-[bis(4-bromophenyl)methyl]piperazin-1-yl]-3-(4-ethoxyphenyl)prop-2-en-1-one (PubChem CID 123767129) has the molecular formula C28H28Br2N2O2 and a molecular weight of 584.35 g/mol. Its IUPAC name is 1-[4-[bis(4-bromophenyl)methyl]piperazin-1-yl]-3-(4-ethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-[4-[bis(4-bromophenyl)methyl]piperazin-1-yl]-3-(4-ethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 123767129 |
| Molecular Formula | C28H28Br2N2O2 |
| Molecular Weight | 584.35 g/mol |
| Exact Mass | 582.05 |
| IUPAC Name | 1-[4-[bis(4-bromophenyl)methyl]piperazin-1-yl]-3-(4-ethoxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1ccc(C=CC(=O)N2CCN(C(c3ccc(Br)cc3)c3ccc(Br)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H28Br2N2O2/c1-2-34-26-14-3-21(4-15-26)5-16-27(33)31-17-19-32(20-18-31)28(22-6-10-24(29)11-7-22)23-8-12-25(30)13-9-23/h3-16,28H,2,17-20H2,1H3 |
| InChIKey | ZPZGEIGQNQBMAR-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.35 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|