C19H28N2O2 — CID 55774798
(E)-1-(4-propan-2-ylpiperazin-1-yl)-3-(4-propoxyphenyl)prop-2-en-1-one (PubChem CID 55774798) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is (E)-1-(4-propan-2-ylpiperazin-1-yl)-3-(4-propoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-propan-2-ylpiperazin-1-yl)-3-(4-propoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 55774798 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (E)-1-(4-propan-2-ylpiperazin-1-yl)-3-(4-propoxyphenyl)prop-2-en-1-one |
| SMILES | CCCOc1ccc(/C=C/C(=O)N2CCN(C(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H28N2O2/c1-4-15-23-18-8-5-17(6-9-18)7-10-19(22)21-13-11-20(12-14-21)16(2)3/h5-10,16H,4,11-15H2,1-3H3/b10-7+ |
| InChIKey | KLSNIMRULTWWFT-JXMROGBWSA-N |
| XLogP | 3.04 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|