C20H27NO4 — CID 56548069
(E)-1-[3-(1,3-dioxolan-2-yl)piperidin-1-yl]-3-(4-propoxyphenyl)prop-2-en-1-one (PubChem CID 56548069) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is (E)-1-[3-(1,3-dioxolan-2-yl)piperidin-1-yl]-3-(4-propoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[3-(1,3-dioxolan-2-yl)piperidin-1-yl]-3-(4-propoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 56548069 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | (E)-1-[3-(1,3-dioxolan-2-yl)piperidin-1-yl]-3-(4-propoxyphenyl)prop-2-en-1-one |
| SMILES | CCCOc1ccc(/C=C/C(=O)N2CCCC(C3OCCO3)C2)cc1 |
| InChI | InChI=1S/C20H27NO4/c1-2-12-23-18-8-5-16(6-9-18)7-10-19(22)21-11-3-4-17(15-21)20-24-13-14-25-20/h5-10,17,20H,2-4,11-15H2,1H3/b10-7+ |
| InChIKey | XUFWDCJZWIPTHL-JXMROGBWSA-N |
| XLogP | 3.10 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|