C16H21NO2 — CID 898049
(E)-3-(4-methoxyphenyl)-1-[(3R)-3-methylpiperidin-1-yl]prop-2-en-1-one (PubChem CID 898049) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-1-[(3R)-3-methylpiperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-methoxyphenyl)-1-[(3R)-3-methylpiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 898049 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-1-[(3R)-3-methylpiperidin-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)N2CCC[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C16H21NO2/c1-13-4-3-11-17(12-13)16(18)10-7-14-5-8-15(19-2)9-6-14/h5-10,13H,3-4,11-12H2,1-2H3/b10-7+/t13-/m1/s1 |
| InChIKey | XNHZHWXEVBHXJA-UTSBKAFOSA-N |
| XLogP | 2.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|