C21H28N2O3 — CID 42119464
N-cyclopropyl-3-[(3R)-1-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]piperidin-3-yl]propanamide (PubChem CID 42119464) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-cyclopropyl-3-[(3R)-1-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]piperidin-3-yl]propanamide.
| Compound Name | N-cyclopropyl-3-[(3R)-1-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 42119464 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | N-cyclopropyl-3-[(3R)-1-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]piperidin-3-yl]propanamide |
| SMILES | COc1ccc(/C=C/C(=O)N2CCC[C@H](CCC(=O)NC3CC3)C2)cc1 |
| InChI | InChI=1S/C21H28N2O3/c1-26-19-10-4-16(5-11-19)7-13-21(25)23-14-2-3-17(15-23)6-12-20(24)22-18-8-9-18/h4-5,7,10-11,13,17-18H,2-3,6,8-9,12,14-15H2,1H3,(H,22,24)/b13-7+/t17-/m1/s1 |
| InChIKey | IYIUOHKBSQHYIJ-SDSFWRRZSA-N |
| XLogP | 3.01 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|