C18H21F2NO4 — CID 75396811
methyl 2-[1-[(E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]piperidin-3-yl]acetate (PubChem CID 75396811) has the molecular formula C18H21F2NO4 and a molecular weight of 353.37 g/mol. Its IUPAC name is methyl 2-[1-[(E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]piperidin-3-yl]acetate.
| Compound Name | methyl 2-[1-[(E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 75396811 |
| Molecular Formula | C18H21F2NO4 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | methyl 2-[1-[(E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]piperidin-3-yl]acetate |
| SMILES | COC(=O)CC1CCCN(C(=O)/C=C/c2ccc(OC(F)F)cc2)C1 |
| InChI | InChI=1S/C18H21F2NO4/c1-24-17(23)11-14-3-2-10-21(12-14)16(22)9-6-13-4-7-15(8-5-13)25-18(19)20/h4-9,14,18H,2-3,10-12H2,1H3/b9-6+ |
| InChIKey | MGJYSMUVSDCQQM-RMKNXTFCSA-N |
| XLogP | 3.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|