C17H21F2NO3 — CID 102603214
3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-(3-methylpiperidin-1-yl)prop-2-en-1-one (PubChem CID 102603214) has the molecular formula C17H21F2NO3 and a molecular weight of 325.36 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-(3-methylpiperidin-1-yl)prop-2-en-1-one.
| Compound Name | 3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-(3-methylpiperidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 102603214 |
| Molecular Formula | C17H21F2NO3 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-(3-methylpiperidin-1-yl)prop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)N2CCCC(C)C2)ccc1OC(F)F |
| InChI | InChI=1S/C17H21F2NO3/c1-12-4-3-9-20(11-12)16(21)8-6-13-5-7-14(23-17(18)19)15(10-13)22-2/h5-8,10,12,17H,3-4,9,11H2,1-2H3 |
| InChIKey | KCEARMUNEXOQMG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|