C20H27NO3 — CID 9295888
(E)-1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 9295888) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is (E)-1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 9295888 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (E)-1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)N2CC[C@@H]3CCCC[C@H]3C2)cc1OC |
| InChI | InChI=1S/C20H27NO3/c1-23-18-9-7-15(13-19(18)24-2)8-10-20(22)21-12-11-16-5-3-4-6-17(16)14-21/h7-10,13,16-17H,3-6,11-12,14H2,1-2H3/b10-8+/t16-,17-/m0/s1 |
| InChIKey | GTRDZAANHGDXSA-LHWQUMODSA-N |
| XLogP | 3.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|