C17H21NO5 — CID 108754214
[2-methoxy-4-[(E)-3-(3-methoxypyrrolidin-1-yl)-3-oxoprop-1-enyl]phenyl] acetate (PubChem CID 108754214) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-(3-methoxypyrrolidin-1-yl)-3-oxoprop-1-enyl]phenyl] acetate.
| Compound Name | [2-methoxy-4-[(E)-3-(3-methoxypyrrolidin-1-yl)-3-oxoprop-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 108754214 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | [2-methoxy-4-[(E)-3-(3-methoxypyrrolidin-1-yl)-3-oxoprop-1-enyl]phenyl] acetate |
| SMILES | COc1cc(/C=C/C(=O)N2CCC(OC)C2)ccc1OC(C)=O |
| InChI | InChI=1S/C17H21NO5/c1-12(19)23-15-6-4-13(10-16(15)22-3)5-7-17(20)18-9-8-14(11-18)21-2/h4-7,10,14H,8-9,11H2,1-3H3/b7-5+ |
| InChIKey | BXARICQSJLRBJL-FNORWQNLSA-N |
| XLogP | 1.88 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|