C22H28F2N2O4 — CID 75127569
3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-[4-(piperidine-1-carbonyl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 75127569) has the molecular formula C22H28F2N2O4 and a molecular weight of 422.47 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-[4-(piperidine-1-carbonyl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-[4-(piperidine-1-carbonyl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 75127569 |
| Molecular Formula | C22H28F2N2O4 |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-[4-(piperidine-1-carbonyl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)N2CCC(C(=O)N3CCCCC3)CC2)ccc1OC(F)F |
| InChI | InChI=1S/C22H28F2N2O4/c1-29-19-15-16(5-7-18(19)30-22(23)24)6-8-20(27)25-13-9-17(10-14-25)21(28)26-11-3-2-4-12-26/h5-8,15,17,22H,2-4,9-14H2,1H3 |
| InChIKey | YGWJTTCTSQYSIC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|