C18H24F2N2O4 — CID 76854431
1-(azepan-1-yl)-2-[[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxypropan-1-one (PubChem CID 76854431) has the molecular formula C18H24F2N2O4 and a molecular weight of 370.40 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxypropan-1-one.
| Compound Name | 1-(azepan-1-yl)-2-[[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxypropan-1-one |
|---|---|
| PubChem CID | 76854431 |
| Molecular Formula | C18H24F2N2O4 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1-(azepan-1-yl)-2-[[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxypropan-1-one |
| SMILES | COc1cc(C=NOC(C)C(=O)N2CCCCCC2)ccc1OC(F)F |
| InChI | InChI=1S/C18H24F2N2O4/c1-13(17(23)22-9-5-3-4-6-10-22)26-21-12-14-7-8-15(25-18(19)20)16(11-14)24-2/h7-8,11-13,18H,3-6,9-10H2,1-2H3 |
| InChIKey | XFKRPIIBDXLDJH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|