C18H18F2N2O4S — CID 24606467
2-[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxy-1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethanone (PubChem CID 24606467) has the molecular formula C18H18F2N2O4S and a molecular weight of 396.42 g/mol. Its IUPAC name is 2-[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxy-1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethanone.
| Compound Name | 2-[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxy-1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethanone |
|---|---|
| PubChem CID | 24606467 |
| Molecular Formula | C18H18F2N2O4S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 2-[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxy-1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethanone |
| SMILES | COc1cc(/C=N/OCC(=O)N2CCc3sccc3C2)ccc1OC(F)F |
| InChI | InChI=1S/C18H18F2N2O4S/c1-24-15-8-12(2-3-14(15)26-18(19)20)9-21-25-11-17(23)22-6-4-16-13(10-22)5-7-27-16/h2-3,5,7-9,18H,4,6,10-11H2,1H3/b21-9+ |
| InChIKey | SKBGEUGYKUQGOS-ZVBGSRNCSA-N |
| XLogP | 3.29 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|